Відмінності між версіями «Лоратадин»

32 байти додано ,  7 років тому
м
нема опису редагування
м (Вилучення 20 інтервікі, відтепер доступних на Вікіданих: d:q424049)
м
| smiles = CCOC(=O)N1CCC(=C2c3ccc(Cl)cc3CCc3cccnc23)CC1
| bioavailability = майже 100%
| protein_bound = 97–9997-99%
| metabolism = Печінка ([[CYP2D6]]- and [[CYP3A4|3A4]]-mediated)
| elimination_half-life = 8 годин, деслоратадин - — 28 годин
| excretion = 40% із сечею<br/>близька кількість із калом
| pregnancy_AU = B1
| pregnancy_US = B
| routes_of_administration = перорально
}}
'''Лоратадин''' -&nbsp;— протиалергічний засіб, [[Антигістамінні препарати|антигістамінний]] засіб для системного застосування.
 
Лоратадин -&nbsp;— H<sub>1</sub>-антигістамін другого покоління, ефективний неседативний антигістамінний препарат довготривалої дії з швидким та вираженим протиалергічним ефектом. Покращання стану зазвичай відмічається вже у перші 30 хвилин після прийому препарату і триває більше 24 годин. Лоратадин та його метаболіти не проникають через гемато-енцефалічний бар'єр. Він не впливає на центральну нервову систему, не виявляє антихолінергічної та седативної дії, не спричиняє звикання. Вік пацієнта, наявність ниркової недостатності та/або порушень функцій печінки не впливають на основні показники фармакокінетики.
 
== Показання ==
 
Лоратадин показаний для лікування сезонного та цілорічного [[алергічний риніт|алергічного риніту]], [[кон'юнктивіт]]у, гострої та хронічної кропив'янки, [[набряк Квінке|набряку Квінке]], симптомів гістамінергій (псевдоалергічних синдромів), спричинених застосуванням гістамінолібераторів, алергічних реакцій на укуси та ужалення, а також у комплексному лікуванні сверблячих [[дерматоз]]ів (контактних [[алергодерматит]]ів, атопічних дерматитів, інших шкірних захворювань алергічної природи, гострих та хронічних [[екзема|екзем]] тощо).
 
У поодиноких випадках відзначались сухість у роті та блювання.
 
{{drug-stub}}
{{Медпопередження}}
 
130 663

редагування