Відмінності між версіями «Пірофосфати»

446 байтів додано ,  9 років тому
м
Бот: Автоматизована заміна тексту: (-Заміна Шаблон:Chembox з англомовними полями на +Шаблон:Речовина з україномовними полями ...
м (Бот: Автоматизована заміна тексту: (-заміна англійських одиниць вимірювання +на українські відповідники та десяткових крапок на коми. ...)
м (Бот: Автоматизована заміна тексту: (-Заміна Шаблон:Chembox з англомовними полями на +Шаблон:Речовина з україномовними полями ...)
{{Речовина
{{Chembox
| verifiedrevid = 401037103
| ImageFileзображення = Pyrophosphate_anion.png
| ImageSize зображення_розмір = 150px
| ImageFile1зображення1 = Pyrophosphate-3D-balls.png
| ImageSize1 зображення_розмір1 = 150px
| зображення_Alt1 =
| ImageAlt1 =
| ImageName1 зображення_підпис1 = Pyrophosphate anion
| IUPACNameIUPAC_назва =
| OtherNamesінші_назви = Дифосфат
| поле1 = {{Речовина Ідентифікатори
| Section1 = {{Chembox Identifiers
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 559142
| InChI = 1/H4O7P2/c1-8(2,3)7-9(4,5)6/h(H2,1,2,3)(H2,4,5,6)/p-4
| InChIKey = XPPKVPWEQAFLFU-XBHQNQODAI
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/H4O7P2/c1-8(2,3)7-9(4,5)6/h(H2,1,2,3)(H2,4,5,6)/p-4
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = XPPKVPWEQAFLFU-UHFFFAOYSA-J
| CASNo номер_CAS =
| PubChem = 644102
| SMILES = [O-]P(=O)([O-])OP(=O)([O-])[O-]
}}
| поле2 = {{Речовина Властивості
| Section2 = {{Chembox Properties
| Formula формула = P<sub>2</sub>O{{su|p=4−|b=7}}
| молярна_маса =
| MolarMass =
| зовнішній_вигляд =
| Appearance =
| Density густина =
| температура_плавлення =
| MeltingPt =
| температура_кипіння =
| BoilingPt =
| Solubility розчинність = }}
| поле3 = {{Речовина Небезпеки
| Section3 = {{Chembox Hazards
| головні_небезпеки =
| MainHazards =
| температура_спалаху =
| FlashPt =
| температура_самозаймання = }}
| Autoignition = }}
}}
 
34 139

редагувань