Відмінності між версіями «Лоратадин»

Ніяких змін в розмірі ,  8 років тому
м
Бот: Автоматизована заміна тексту: (-заміна англійських одиниць вимірювання +на українські відповідники та десяткових крапок на коми. ...
м (r2.7.1) (робот додав: it:Loratadina)
м (Бот: Автоматизована заміна тексту: (-заміна англійських одиниць вимірювання +на українські відповідники та десяткових крапок на коми. ...)
| DrugBank = APRD00384
| C = 22 | H = 23 | Cl = 1 | N = 2 | O = 2
| molecular_weight = 382.,88 г/моль
| smiles = CCOC(=O)N1CCC(=C2c3ccc(Cl)cc3CCc3cccnc23)CC1
| bioavailability = майже 100%
34 096

редагувань