Відмінності між версіями «Пірофосфати»

1526 байтів додано ,  10 років тому
нема опису редагування
(Створена сторінка: Пірофосфати - аніони, солі та ефіри пірофосфатної кислоти. Спочатку пірофосфати були од...)
 
{{Chembox
Пірофосфати - аніони, солі та ефіри пірофосфатної кислоти. Спочатку пірофосфати були одержані при нагріванні фосфатів, "піро" (грец.) означає вогонь.
| verifiedrevid = 401037103
Велике значення пірофосфатів у біохімії, аніон P2O74− позначається PPi (англ. PyroPhosphate inorganic, пірофосфат неорганічний) і утворюється, наприклад, в результаті гідролізу АТФ в АМФ у клітині.
| ImageFile = Pyrophosphate_anion.png
ATP → AMP + PPi
| ImageSize = 150px
| ImageFile1 = Pyrophosphate-3D-balls.png
| ImageSize1 = 150px
| ImageAlt1 =
| ImageName1 = Pyrophosphate anion
| IUPACName =
| OtherNames = Дифосфат
| Section1 = {{Chembox Identifiers
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 559142
| InChI = 1/H4O7P2/c1-8(2,3)7-9(4,5)6/h(H2,1,2,3)(H2,4,5,6)/p-4
| InChIKey = XPPKVPWEQAFLFU-XBHQNQODAI
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/H4O7P2/c1-8(2,3)7-9(4,5)6/h(H2,1,2,3)(H2,4,5,6)/p-4
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = XPPKVPWEQAFLFU-UHFFFAOYSA-J
| CASNo =
| PubChem = 644102
| SMILES = [O-]P(=O)([O-])OP(=O)([O-])[O-]
}}
| Section2 = {{Chembox Properties
| Formula = P<sub>2</sub>O<sub>7</sub><sup>4−</sup>
| MolarMass =
| Appearance =
| Density =
| MeltingPt =
| BoilingPt =
| Solubility = }}
| Section3 = {{Chembox Hazards
| MainHazards =
| FlashPt =
| Autoignition = }}
}}
 
'''Пірофосфати''' (від грецької Пірофосфати«піро»&nbsp;— -вогонь)&nbsp;— аніони[[аніон]]и, солі та ефіри [[пірофосфатна кислота|пірофосфатної кислоти]]. Спочатку пірофосфати були одержані при нагріванні фосфатів, "піро" (грец.) означає вогонь[[фосфат]]ів.
 
Пірофосфати мають Великевелике значення пірофосфатів у [[біохімія|біохімії]], аніон P2O74− позначається PPi (англ. {{lang-en|PyroPhosphate inorganic,}}&nbsp;— неорганічний пірофосфат неорганічний) і утворюється, наприклад, в результаті гідролізу АТФ в АМФ у клітині.
 
{{початок цитати}}
ATP → AMP + PPi
{{кінець цитати}}
 
{{biochem-stub}}
 
[[Категорія:Неорганічні кислоти]]
 
[[bg:Дифосфат]]
[[ca:Pirofosfat]]
[[de:Diphosphate]]
[[en:Pyrophosphate]]
[[es:Pirofosfato]]
[[fr:Pyrophosphate]]
[[hu:Difoszfátok]]
[[it:Pirofosfato]]
[[nl:Pyrofosfaat]]
[[pl:Pirofosforany]]
[[pt:Pirofosfato]]
[[sv:Pyrofosfat]]