Відмінності між версіями «Андростендіон»

нема опису редагування
{{Drugbox
[[Файл:Androstendion.svg|міні|200пкс|Графічна формула андростендіону]]
| verifiedrevid = 443662098
| IUPAC_name = 4-Androstene-3,17-dione
| image = Androstendion.svg
| image2 = Androstediona3D.png
<!--Clinical data-->
| pregnancy_category =
| legal_status = [[Schedule III controlled substances|Schedule III]] (US)
| routes_of_administration =
<!--Pharmacokinetic data-->
| bioavailability =
| metabolism = [[печінка]]
| excretion =
<!--Identifiers-->
| CAS_number_Ref = {{cascite|correct|}}
| CAS_number = 63-05-8
| ATC_prefix = none
| PubChem = 6128
| IUPHAR_ligand = 2860
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB01536
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 5898
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 409J2J96VR
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 16422
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 274826
<!--Chemical data-->
| C=19 | H=26
| O=2
| molecular_weight = 286.4 g/mol
| smiles = O=C4/C=C3/CC[C@@H]2[C@H](CC[C@@]1(C(=O)CC[C@H]12)C)[C@@]3(C)CC4
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C19H26O2/c1-18-9-7-13(20)11-12(18)3-4-14-15-5-6-17(21)19(15,2)10-8-16(14)18/h11,14-16H,3-10H2,1-2H3/t14-,15-,16-,18-,19-/m0/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = AEMFNILZOJDQLW-QAGGRKNESA-N
}}
 
'''Андростендіон'''&nbsp;— основний [[андроген]], що секретуються [[яєчники|яєчниками]].