Діетилпірокарбонат

хімічна сполука

Діети́лпірокарбона́т (ДЕПК, DEPC) — хімічна сполука, естер пірокарбонатної кислоти.

Діетилпірокарбонат
Diethyl pyrocarbonate.svg
Ідентифікатори
Номер CAS 1609-47-8
Номер EINECS 216-542-8
KEGG C11592
ChEBI 59051
SMILES
CCOC(=O)OC(=O)OCC[1]
InChI
InChI=1S/C6H10O5/c1-3-9-5(7)11-6(8)10-4-2/h3-4H2,1-2H3
Номер Бельштейна 637031
Номер Гмеліна 602268
Якщо не зазначено інше, дані наведено для речовин у стандартному стані (за 25 °C, 100 кПа)
Інструкція з використання шаблону
Примітки картки

Використовується в молекулярній біології як інгібітор рибонуклеаз — ферментів, що руйнують РНК. Розчином діетилпірокарбонату оброблюють прилади та матеріали, які безпосередньо контактують з розчинами РНК.


  1. diethyl pyrocarbonate