Валін

хімічна сполука

Валі́н — хімічна сполука, одна з двадцяти канонічних протеїногенних амінокислот, що використовуються всіма живими організмами на землі для біосинтезу білків. Позначається трилітерним скороченням Val або однолітерним скороченням V. При трансляції може кодуватися кодонами мРНК GUU, GUC, GUA, а також GUG. Бічний ланцюг у валіна представлений ізопропільним замісником, завдяки чому валін відносять до групи гідрофобних амінокислот.

Валін
L-Valin - L-Valine.svg
Ідентифікатори
Номер CAS 516-06-3
Номер EINECS 200-773-6
DrugBank 00161
KEGG D00039 і C00183
ChEBI 16414 і 57762
SMILES
CC(C)[C@@H](C(=O)O)N
InChI
InChI=1S/C5H11NO2/c1-3(2)4(6)5(7)8/h3-4H,6H2,1-2H3,(H,7,8)/t4-/m0/s1
Номер Бельштейна 1721136
Номер Гмеліна 2826
Властивості
Молекулярна формула C5H11NO2
Молярна маса 117,15 г/моль
Якщо не зазначено інше, дані наведено для речовин у стандартному стані (за 25 °C, 100 кПа)
Інструкція з використання шаблону
Примітки картки

ІсторіяРедагувати

Вперше валін був виділений із казеїну в 1901 році Емілем Фішером.[1] Назва валін була запропонована завдяки подібності валіну до валеріанової кислоти, яка в свою чергу отримала назву від валеріани.[2][3]

ПриміткиРедагувати

  1. valine. Encyclopaedia Britannica Online. Процитовано 2015-12-06. 
  2. valine. Merriam-Webster Online Dictionary. Процитовано 2015-12-06. 
  3. valeric acid. Merriam-Webster Online Dictionary. Процитовано 2015-12-06. 

ПосиланняРедагувати