Відмінності між версіями «Рифампіцин»

2356 байтів додано ,  11 років тому
нема опису редагування
м (робот додав: zh:利福平)
| verifiedrevid = 400305846
|IUPAC_name = (7''S'',9''E'',11''S'',12''R'',13''S'',14''R'',15''R'',16''R'',17''S'',18''S'',19''E'',21''Z'')-2,15,17,27,29-pentahydroxy-11-methoxy-3,7,12,14,16,18,22-heptamethyl-26-{(E)-[(4-methylpiperazin-1-yl)imino]methyl}-6,23-dioxo-8,30-dioxa-24-azatetracyclo[<sup>4,7</sup>.0<sup>5,28</sup>]triaconta-1(28),2,4,9,19,21,25(29),26-octaen-13-yl acetate
|synonyms=<small>5,6,9,17,19,21-Hexahydroxy-23-methoxy-2,4,12,16,18,20,22-heptamethyl-8-[''N''-(4-methyl-1-piperazinyl)formimidoyl]-2,7-(epoxypentadeca[1,11,13]trienimino)-naphtho[2,1-''b'']furan-1,11(2''H'')-dione 21-acetate</small>
|InChI = 1/C43H58N4O12/c1-21-12-11-13-22(2)42(55)45-33-28(20-44-47-17-15-46(9)16-18-47)37(52)30-31(38(33)53)36(51)26(6)40-32(30)41(54)43(8,59-40)57-19-14-29(56-10)23(3)39(58-27(7)48)25(5)35(50)24(4)34(21)49/h11-14,19-21,23-25,29,34-35,39,44,49-51,53H,15-18H2,1-10H3,(H,45,55)/b12-11-,19-14+,22-13+,28-20+/t21-,23-,24-,25-,29-,34+,35+,39-,43-/m0/s1
| smiles = O=C/2c3c5C(=O)[C@]4(O/C=C/[C@H](OC)[C@@H]([C@H](OC(=O)C)[C@@H](C)[C@H](O)[C@@H](C)[C@H](O)[C@H](/C=C\C=C(/C(=O)NC(/C\2=C\NN1CCN(C)CC1)=C(\O)c3c(O)c(c5O4)C)C)C)C)C
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C43H58N4O12/c1-21-12-11-13-22(2)42(55)45-33-28(20-44-47-17-15-46(9)16-18-47)37(52)30-31(38(33)53)36(51)26(6)40-32(30)41(54)43(8,59-40)57-19-14-29(56-10)23(3)39(58-27(7)48)25(5)35(50)24(4)34(21)49/h11-14,19-21,23-25,29,34-35,39,44,49-51,53H,15-18H2,1-10H3,(H,45,55)/b12-11-,19-14+,22-13+,28-20+/t21-,23-,24-,25-,29-,34+,35+,39-,43-/m0/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| CAS_number = 13292-46-1
| ATC_prefix=J04
| ATC_suffix=AB02
| ATC_supplemental={{ATCvet|J54|AB02}}
| PubChem=5360416
| DrugBank=APRD00207
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID=4529237
| C = 43 | H = 58 | N = 4 | O = 12
|molecular_weight = 822.94 г/моль
| melting_point = 183
| melting_high = 188
|bioavailability = 90 to 95%
|metabolism = печінка та кишкова стінка
|elimination_half-life = від 6 до 7 годин
|excretion = 15 to 30% нирки<br />60% з калом
|pregnancy_AU = C
|legal_AU = S4
|legal_UK = POM
|routes_of_administration = перорально, внутрішньовенно
'''Рифампіци́н''', або '''рифампі́н''' - це [[бактерії|бактерицидний]] [[антибіотик]] [[рифампіцинова група|рифампіцинової групи]]. Це напівсинтетична речовина, яку отримують з бактерії ''Amycolatopsis rifamycinica'', також відомої як ''Amycolatopsis mediterranei'' та ''Streptomyces mediterranei''. Для позначення рифампіцину використовують скорочення RIF, RMP, RD, RA та R.
16 112
