Андростендіон: відмінності між версіями

хімічна сполука
[неперевірена версія][перевірена версія]
м (r2.7.1) (робот додав: ru:Андростендион)
м (вилучена Категорія:Стероїдні гормони за допомогою HotCat)
 
(Не показані 14 проміжних версій 8 користувачів)
Рядок 1: Рядок 1:
{{Drugbox
[[Файл:Androstendion.svg|міні|200пкс|Графічна формула андростендіону]]
| verifiedrevid = 443662098
'''Андростендіон''' — основний [[андроген]], що секретуються [[яєчники|яєчниками]].
| IUPAC_name = 4-Androstene-3,17-dione
| image = Androstendion.svg
| image2 = Androstediona3D.png
<!--Clinical data-->
| pregnancy_category =
| legal_status = [[Schedule III controlled substances|Schedule III]] (US)
| routes_of_administration =
<!--Pharmacokinetic data-->
| bioavailability =
| metabolism = [[печінка]]
| excretion =
<!--Identifiers-->
| CAS_number_Ref = {{cascite|correct|}}
| CAS_number = 63-05-8
| ATC_prefix = none
| PubChem = 6128
| IUPHAR_ligand = 2860
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB01536
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 5898
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 409J2J96VR
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 16422
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 274826
<!--Chemical data-->
| C=19 | H=26
| O=2
| molecular_weight = 286.4 g/mol
| smiles = O=C4/C=C3/CC[C@@H]2[C@H](CC[C@@]1(C(=O)CC[C@H]12)C)[C@@]3(C)CC4
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C19H26O2/c1-18-9-7-13(20)11-12(18)3-4-14-15-5-6-17(21)19(15,2)10-8-16(14)18/h11,14-16H,3-10H2,1-2H3/t14-,15-,16-,18-,19-/m0/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = AEMFNILZOJDQLW-QAGGRKNESA-N
}}


'''Андростендіон'''&nbsp;— основний [[андроген]], що секретуються [[яєчники|яєчниками]].<ref name=williams>{{cite book|last1=Melmed|first1=S|last2=Polonsky|first2=KS|last3=Larsen|first3=PR|last4=Kronenberg|first4=HM|title=Williams Textbook of Endocrinology|date=2011|publisher=Saunders|page=|isbn=978-1416029113|edition=11th}}</ref><ref>{{cite book |автор= [[Шевчук Віктор Григорович|Шевчук, В. Г.]], В.&nbsp;М.&nbsp;Мороз, С.&nbsp;М.&nbsp;Бєлан, М.&nbsp;Р.&nbsp;Гжегоцький, М.&nbsp;В.&nbsp;Йолтухівський|назва=Фізіологія. |переклад= |видання=2, Підручник для ВМНЗ IV р. |дата=|рік=2015|видавництво= Нова Книга|знаходження= Вінниця|сторінки=|isbn=9789663825328}}</ref>
Також в невеликих кількостях секретується корою [[наднирники|наднирників]] у обох статей і [[яєчка]]ми у чоловіків. Андрогенна дія андростендіону проявляється значно слабкіше, ніж у [[тестостерон]]у.

Також в невеликих кількостях секретується корою [[наднирники|наднирників]] у обох статей і [[яєчка]]ми у чоловіків. Андрогенна дія андростендіону проявляється значно слабкіше, ніж у [[тестостерон]]у.


Андростендіон перетвориться в [[естрогени]], головним чином у яєчниках, але також і в [[жирова тканина|жировій тканині]]. Можливе перетворення андростендіону в [[тестостерон]], але в нормі у жінок цей процес майже не відбувається. Посилення продукції тестостерону з андростендіону, наприклад, за наявності андрогенпродукуючої пухлини, часто призводить до [[гірсутизм]]у і навіть вірільності.
Андростендіон перетвориться в [[естрогени]], головним чином у яєчниках, але також і в [[жирова тканина|жировій тканині]]. Можливе перетворення андростендіону в [[тестостерон]], але в нормі у жінок цей процес майже не відбувається. Посилення продукції тестостерону з андростендіону, наприклад, за наявності андрогенпродукуючої пухлини, часто призводить до [[гірсутизм]]у і навіть вірільності.


{{biol-stub}}
[[Категорія:Стероїди]]
[[Категорія:Андрогени]]
[[Категорія:гормони]]


== Примітки ==
[[ca:Androstendiona]]
{{reflist}}
[[de:Androstendion]]
[[Категорія:Андрогени]]
[[en:Androstenedione]]
[[es:Androstenediona]]
[[fi:Androstenedioni]]
[[ja:アンドロステンジオン]]
[[nl:Androsteendion]]
[[no:Androstenedion]]
[[pt:Androstenediona]]
[[ru:Андростендион]]
[[sv:Androstendion]]
[[zh:雄烯二酮]]

Поточна версія на 18:15, 11 жовтня 2017

Андростендіон — основний андроген, що секретуються яєчниками.[1][2]

Андростендіон
Androstendion.svg
Androstediona3D.png
Систематична назва (IUPAC)
4-Androstene-3,17-dione
Ідентифікатори
Номер CAS 63-05-8
Код ATC none
PubChem 6128
DrugBank DB01536
Хімічні дані
Формула C19H26O2 
Мол. маса 286.4 g/mol
SMILES eMolecules & PubChem
Фармакокінетичні дані
Біодоступність ?
Метаболізм печінка
Період напіврозпаду ?
Виділення ?
Терапевтичні застереження
Кат. вагітності

?

Лег. статус

Schedule III (US)

Використання ?

Також в невеликих кількостях секретується корою наднирників у обох статей і яєчками у чоловіків. Андрогенна дія андростендіону проявляється значно слабкіше, ніж у тестостерону.

Андростендіон перетвориться в естрогени, головним чином у яєчниках, але також і в жировій тканині. Можливе перетворення андростендіону в тестостерон, але в нормі у жінок цей процес майже не відбувається. Посилення продукції тестостерону з андростендіону, наприклад, за наявності андрогенпродукуючої пухлини, часто призводить до гірсутизму і навіть вірільності.


ПриміткиРедагувати

  1. Melmed, S; Polonsky, KS; Larsen, PR; Kronenberg, HM (2011). Williams Textbook of Endocrinology (вид. 11th). Saunders. ISBN 978-1416029113. 
  2.  Шевчук, В. Г., В. М. Мороз, С. М. Бєлан, М. Р. Гжегоцький, М. В. Йолтухівський (2015). Фізіологія. (вид. 2, Підручник для ВМНЗ IV р.). Вінниця: Нова Книга. ISBN 9789663825328.